C18H22Cl2N6O — CID 55697068
1-(2,4-dichlorophenyl)-3-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]urea (PubChem CID 55697068) has the molecular formula C18H22Cl2N6O and a molecular weight of 409.32 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-3-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]urea.
| Compound Name | 1-(2,4-dichlorophenyl)-3-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]urea |
|---|---|
| PubChem CID | 55697068 |
| Molecular Formula | C18H22Cl2N6O |
| Molecular Weight | 409.32 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-3-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]urea |
| SMILES | O=C(NCCCN1CCN(c2ncccn2)CC1)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H22Cl2N6O/c19-14-3-4-16(15(20)13-14)24-18(27)23-7-2-8-25-9-11-26(12-10-25)17-21-5-1-6-22-17/h1,3-6,13H,2,7-12H2,(H2,23,24,27) |
| InChIKey | UCJFIVUPRLMQSC-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.32 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|