C19H26Cl2N8O — CID 55792435
1-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-3-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]urea (PubChem CID 55792435) has the molecular formula C19H26Cl2N8O and a molecular weight of 453.38 g/mol. Its IUPAC name is 1-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-3-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]urea.
| Compound Name | 1-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-3-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]urea |
|---|---|
| PubChem CID | 55792435 |
| Molecular Formula | C19H26Cl2N8O |
| Molecular Weight | 453.38 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | 1-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-3-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]urea |
| SMILES | O=C(NCCCN1CCN(c2ncccn2)CC1)NCCNc1ncc(Cl)cc1Cl |
| InChI | InChI=1S/C19H26Cl2N8O/c20-15-13-16(21)17(27-14-15)22-6-7-26-19(30)25-5-2-8-28-9-11-29(12-10-28)18-23-3-1-4-24-18/h1,3-4,13-14H,2,5-12H2,(H,22,27)(H2,25,26,30) |
| InChIKey | QBWUZNIWGOJLFA-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 98.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.38 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|