C19H23Cl2N5O — CID 52657963
4-benzyl-N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]piperazine-1-carboxamide (PubChem CID 52657963) has the molecular formula C19H23Cl2N5O and a molecular weight of 408.33 g/mol. Its IUPAC name is 4-benzyl-N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]piperazine-1-carboxamide.
| Compound Name | 4-benzyl-N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 52657963 |
| Molecular Formula | C19H23Cl2N5O |
| Molecular Weight | 408.33 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | 4-benzyl-N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]piperazine-1-carboxamide |
| SMILES | O=C(NCCNc1ncc(Cl)cc1Cl)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C19H23Cl2N5O/c20-16-12-17(21)18(24-13-16)22-6-7-23-19(27)26-10-8-25(9-11-26)14-15-4-2-1-3-5-15/h1-5,12-13H,6-11,14H2,(H,22,24)(H,23,27) |
| InChIKey | CJBPOULBDBPWCY-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 60.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.33 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|