C15H22Cl2N4O — CID 71883141
N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-4-methylazepane-1-carboxamide (PubChem CID 71883141) has the molecular formula C15H22Cl2N4O and a molecular weight of 345.27 g/mol. Its IUPAC name is N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-4-methylazepane-1-carboxamide.
| Compound Name | N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-4-methylazepane-1-carboxamide |
|---|---|
| PubChem CID | 71883141 |
| Molecular Formula | C15H22Cl2N4O |
| Molecular Weight | 345.27 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-4-methylazepane-1-carboxamide |
| SMILES | CC1CCCN(C(=O)NCCNc2ncc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C15H22Cl2N4O/c1-11-3-2-7-21(8-4-11)15(22)19-6-5-18-14-13(17)9-12(16)10-20-14/h9-11H,2-8H2,1H3,(H,18,20)(H,19,22) |
| InChIKey | VHJDKLPCIFIPIN-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.27 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|