C17H25Cl2N5O — CID 55808870
4-cyclopentyl-N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]piperazine-1-carboxamide (PubChem CID 55808870) has the molecular formula C17H25Cl2N5O and a molecular weight of 386.33 g/mol. Its IUPAC name is 4-cyclopentyl-N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]piperazine-1-carboxamide.
| Compound Name | 4-cyclopentyl-N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 55808870 |
| Molecular Formula | C17H25Cl2N5O |
| Molecular Weight | 386.33 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | 4-cyclopentyl-N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]piperazine-1-carboxamide |
| SMILES | O=C(NCCNc1ncc(Cl)cc1Cl)N1CCN(C2CCCC2)CC1 |
| InChI | InChI=1S/C17H25Cl2N5O/c18-13-11-15(19)16(22-12-13)20-5-6-21-17(25)24-9-7-23(8-10-24)14-3-1-2-4-14/h11-12,14H,1-10H2,(H,20,22)(H,21,25) |
| InChIKey | HDJMVUDQUYRRGB-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 60.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.33 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|