C13H18Cl2N4O2 — CID 111443706
N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-3-(hydroxymethyl)pyrrolidine-1-carboxamide (PubChem CID 111443706) has the molecular formula C13H18Cl2N4O2 and a molecular weight of 333.22 g/mol. Its IUPAC name is N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-3-(hydroxymethyl)pyrrolidine-1-carboxamide.
| Compound Name | N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-3-(hydroxymethyl)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 111443706 |
| Molecular Formula | C13H18Cl2N4O2 |
| Molecular Weight | 333.22 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | N-[2-[(3,5-dichloro-2-pyridinyl)amino]ethyl]-3-(hydroxymethyl)pyrrolidine-1-carboxamide |
| SMILES | O=C(NCCNc1ncc(Cl)cc1Cl)N1CCC(CO)C1 |
| InChI | InChI=1S/C13H18Cl2N4O2/c14-10-5-11(15)12(18-6-10)16-2-3-17-13(21)19-4-1-9(7-19)8-20/h5-6,9,20H,1-4,7-8H2,(H,16,18)(H,17,21) |
| InChIKey | TUYHEXCREJBRAF-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 77.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.22 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|