C13H20ClN3O3S — CID 115966945
[1-[[5-chloro-6-(propylamino)-3-pyridinyl]sulfonyl]pyrrolidin-3-yl]methanol (PubChem CID 115966945) has the molecular formula C13H20ClN3O3S and a molecular weight of 333.84 g/mol. Its IUPAC name is [1-[[5-chloro-6-(propylamino)-3-pyridinyl]sulfonyl]pyrrolidin-3-yl]methanol.
| Compound Name | [1-[[5-chloro-6-(propylamino)-3-pyridinyl]sulfonyl]pyrrolidin-3-yl]methanol |
|---|---|
| PubChem CID | 115966945 |
| Molecular Formula | C13H20ClN3O3S |
| Molecular Weight | 333.84 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | [1-[[5-chloro-6-(propylamino)-3-pyridinyl]sulfonyl]pyrrolidin-3-yl]methanol |
| SMILES | CCCNc1ncc(S(=O)(=O)N2CCC(CO)C2)cc1Cl |
| InChI | InChI=1S/C13H20ClN3O3S/c1-2-4-15-13-12(14)6-11(7-16-13)21(19,20)17-5-3-10(8-17)9-18/h6-7,10,18H,2-5,8-9H2,1H3,(H,15,16) |
| InChIKey | KEHQRJXQCFZVDU-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.84 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |