C14H22ClN3O2S — CID 64606620
5-chloro-N-(cyclopentylmethyl)-6-(propylamino)pyridine-3-sulfonamide (PubChem CID 64606620) has the molecular formula C14H22ClN3O2S and a molecular weight of 331.87 g/mol. Its IUPAC name is 5-chloro-N-(cyclopentylmethyl)-6-(propylamino)pyridine-3-sulfonamide.
| Compound Name | 5-chloro-N-(cyclopentylmethyl)-6-(propylamino)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 64606620 |
| Molecular Formula | C14H22ClN3O2S |
| Molecular Weight | 331.87 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | 5-chloro-N-(cyclopentylmethyl)-6-(propylamino)pyridine-3-sulfonamide |
| SMILES | CCCNc1ncc(S(=O)(=O)NCC2CCCC2)cc1Cl |
| InChI | InChI=1S/C14H22ClN3O2S/c1-2-7-16-14-13(15)8-12(10-17-14)21(19,20)18-9-11-5-3-4-6-11/h8,10-11,18H,2-7,9H2,1H3,(H,16,17) |
| InChIKey | JVNOIUOKYLIAQZ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.87 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |