C12H14ClN3O2S2 — CID 66354828
5-chloro-6-(propylamino)-N-thiophen-3-ylpyridine-3-sulfonamide (PubChem CID 66354828) has the molecular formula C12H14ClN3O2S2 and a molecular weight of 331.85 g/mol. Its IUPAC name is 5-chloro-6-(propylamino)-N-thiophen-3-ylpyridine-3-sulfonamide.
| Compound Name | 5-chloro-6-(propylamino)-N-thiophen-3-ylpyridine-3-sulfonamide |
|---|---|
| PubChem CID | 66354828 |
| Molecular Formula | C12H14ClN3O2S2 |
| Molecular Weight | 331.85 g/mol |
| Exact Mass | 331.02 |
| IUPAC Name | 5-chloro-6-(propylamino)-N-thiophen-3-ylpyridine-3-sulfonamide |
| SMILES | CCCNc1ncc(S(=O)(=O)Nc2ccsc2)cc1Cl |
| InChI | InChI=1S/C12H14ClN3O2S2/c1-2-4-14-12-11(13)6-10(7-15-12)20(17,18)16-9-3-5-19-8-9/h3,5-8,16H,2,4H2,1H3,(H,14,15) |
| InChIKey | SKISJXSGNYITFE-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.85 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |