C11H14N4O2S2 — CID 66353570
2-(propylamino)-N-thiophen-3-ylpyrimidine-5-sulfonamide (PubChem CID 66353570) has the molecular formula C11H14N4O2S2 and a molecular weight of 298.39 g/mol. Its IUPAC name is 2-(propylamino)-N-thiophen-3-ylpyrimidine-5-sulfonamide.
| Compound Name | 2-(propylamino)-N-thiophen-3-ylpyrimidine-5-sulfonamide |
|---|---|
| PubChem CID | 66353570 |
| Molecular Formula | C11H14N4O2S2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 2-(propylamino)-N-thiophen-3-ylpyrimidine-5-sulfonamide |
| SMILES | CCCNc1ncc(S(=O)(=O)Nc2ccsc2)cn1 |
| InChI | InChI=1S/C11H14N4O2S2/c1-2-4-12-11-13-6-10(7-14-11)19(16,17)15-9-3-5-18-8-9/h3,5-8,15H,2,4H2,1H3,(H,12,13,14) |
| InChIKey | OTDBRXWWCLUARZ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |