C9H10N4O2S2 — CID 66355225
6-hydrazinyl-N-thiophen-3-ylpyridine-3-sulfonamide (PubChem CID 66355225) has the molecular formula C9H10N4O2S2 and a molecular weight of 270.34 g/mol. Its IUPAC name is 6-hydrazinyl-N-thiophen-3-ylpyridine-3-sulfonamide.
| Compound Name | 6-hydrazinyl-N-thiophen-3-ylpyridine-3-sulfonamide |
|---|---|
| PubChem CID | 66355225 |
| Molecular Formula | C9H10N4O2S2 |
| Molecular Weight | 270.34 g/mol |
| Exact Mass | 270.02 |
| IUPAC Name | 6-hydrazinyl-N-thiophen-3-ylpyridine-3-sulfonamide |
| SMILES | NNc1ccc(S(=O)(=O)Nc2ccsc2)cn1 |
| InChI | InChI=1S/C9H10N4O2S2/c10-12-9-2-1-8(5-11-9)17(14,15)13-7-3-4-16-6-7/h1-6,13H,10H2,(H,11,12) |
| InChIKey | AYFUNJOVCOXOOO-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.34 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|