C8H10N6O2S — CID 43540315
6-hydrazinyl-N-(1H-pyrazol-4-yl)pyridine-3-sulfonamide (PubChem CID 43540315) has the molecular formula C8H10N6O2S and a molecular weight of 254.28 g/mol. Its IUPAC name is 6-hydrazinyl-N-(1H-pyrazol-4-yl)pyridine-3-sulfonamide.
| Compound Name | 6-hydrazinyl-N-(1H-pyrazol-4-yl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 43540315 |
| Molecular Formula | C8H10N6O2S |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | 6-hydrazinyl-N-(1H-pyrazol-4-yl)pyridine-3-sulfonamide |
| SMILES | NNc1ccc(S(=O)(=O)Nc2cn[nH]c2)cn1 |
| InChI | InChI=1S/C8H10N6O2S/c9-13-8-2-1-7(5-10-8)17(15,16)14-6-3-11-12-4-6/h1-5,14H,9H2,(H,10,13)(H,11,12) |
| InChIKey | WPHYDYFVNVGXHY-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 125.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|