C8H10N6O2S — CID 62145901
2-(methylamino)-N-(1H-pyrazol-4-yl)pyrimidine-5-sulfonamide (PubChem CID 62145901) has the molecular formula C8H10N6O2S and a molecular weight of 254.28 g/mol. Its IUPAC name is 2-(methylamino)-N-(1H-pyrazol-4-yl)pyrimidine-5-sulfonamide.
| Compound Name | 2-(methylamino)-N-(1H-pyrazol-4-yl)pyrimidine-5-sulfonamide |
|---|---|
| PubChem CID | 62145901 |
| Molecular Formula | C8H10N6O2S |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | 2-(methylamino)-N-(1H-pyrazol-4-yl)pyrimidine-5-sulfonamide |
| SMILES | CNc1ncc(S(=O)(=O)Nc2cn[nH]c2)cn1 |
| InChI | InChI=1S/C8H10N6O2S/c1-9-8-10-4-7(5-11-8)17(15,16)14-6-2-12-13-3-6/h2-5,14H,1H3,(H,12,13)(H,9,10,11) |
| InChIKey | YWNLZNFAXVRIGW-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 112.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |