C11H10F2N4O2S — CID 62144941
N-(2,6-difluorophenyl)-2-(methylamino)pyrimidine-5-sulfonamide (PubChem CID 62144941) has the molecular formula C11H10F2N4O2S and a molecular weight of 300.29 g/mol. Its IUPAC name is N-(2,6-difluorophenyl)-2-(methylamino)pyrimidine-5-sulfonamide.
| Compound Name | N-(2,6-difluorophenyl)-2-(methylamino)pyrimidine-5-sulfonamide |
|---|---|
| PubChem CID | 62144941 |
| Molecular Formula | C11H10F2N4O2S |
| Molecular Weight | 300.29 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | N-(2,6-difluorophenyl)-2-(methylamino)pyrimidine-5-sulfonamide |
| SMILES | CNc1ncc(S(=O)(=O)Nc2c(F)cccc2F)cn1 |
| InChI | InChI=1S/C11H10F2N4O2S/c1-14-11-15-5-7(6-16-11)20(18,19)17-10-8(12)3-2-4-9(10)13/h2-6,17H,1H3,(H,14,15,16) |
| InChIKey | QOCQUMZNLGZYIU-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.29 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |