C11H6Cl2F2N2O2S — CID 64625188
5,6-dichloro-N-(2,6-difluorophenyl)pyridine-3-sulfonamide (PubChem CID 64625188) has the molecular formula C11H6Cl2F2N2O2S and a molecular weight of 339.15 g/mol. Its IUPAC name is 5,6-dichloro-N-(2,6-difluorophenyl)pyridine-3-sulfonamide.
| Compound Name | 5,6-dichloro-N-(2,6-difluorophenyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 64625188 |
| Molecular Formula | C11H6Cl2F2N2O2S |
| Molecular Weight | 339.15 g/mol |
| Exact Mass | 337.95 |
| IUPAC Name | 5,6-dichloro-N-(2,6-difluorophenyl)pyridine-3-sulfonamide |
| SMILES | O=S(=O)(Nc1c(F)cccc1F)c1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H6Cl2F2N2O2S/c12-7-4-6(5-16-11(7)13)20(18,19)17-10-8(14)2-1-3-9(10)15/h1-5,17H |
| InChIKey | GJYFVFHFOSXAAV-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.15 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|