C12H10Cl2N2O3S — CID 64606325
5,6-dichloro-N-(4-hydroxy-2-methylphenyl)pyridine-3-sulfonamide (PubChem CID 64606325) has the molecular formula C12H10Cl2N2O3S and a molecular weight of 333.20 g/mol. Its IUPAC name is 5,6-dichloro-N-(4-hydroxy-2-methylphenyl)pyridine-3-sulfonamide.
| Compound Name | 5,6-dichloro-N-(4-hydroxy-2-methylphenyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 64606325 |
| Molecular Formula | C12H10Cl2N2O3S |
| Molecular Weight | 333.20 g/mol |
| Exact Mass | 331.98 |
| IUPAC Name | 5,6-dichloro-N-(4-hydroxy-2-methylphenyl)pyridine-3-sulfonamide |
| SMILES | Cc1cc(O)ccc1NS(=O)(=O)c1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H10Cl2N2O3S/c1-7-4-8(17)2-3-11(7)16-20(18,19)9-5-10(13)12(14)15-6-9/h2-6,16-17H,1H3 |
| InChIKey | WUNOMOIHMUOSGK-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.20 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|