C13H10Cl2N2O4S — CID 4730940
methyl 2-[(5,6-dichloro-3-pyridinyl)sulfonylamino]benzoate (PubChem CID 4730940) has the molecular formula C13H10Cl2N2O4S and a molecular weight of 361.21 g/mol. Its IUPAC name is methyl 2-[(5,6-dichloro-3-pyridinyl)sulfonylamino]benzoate.
| Compound Name | methyl 2-[(5,6-dichloro-3-pyridinyl)sulfonylamino]benzoate |
|---|---|
| PubChem CID | 4730940 |
| Molecular Formula | C13H10Cl2N2O4S |
| Molecular Weight | 361.21 g/mol |
| Exact Mass | 359.97 |
| IUPAC Name | methyl 2-[(5,6-dichloro-3-pyridinyl)sulfonylamino]benzoate |
| SMILES | COC(=O)c1ccccc1NS(=O)(=O)c1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H10Cl2N2O4S/c1-21-13(18)9-4-2-3-5-11(9)17-22(19,20)8-6-10(14)12(15)16-7-8/h2-7,17H,1H3 |
| InChIKey | LCBGNGMBMFGQDU-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.21 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|