C12H8Cl2N2O4S — CID 64607834
2-[(5,6-dichloro-3-pyridinyl)sulfonylamino]benzoic acid (PubChem CID 64607834) has the molecular formula C12H8Cl2N2O4S and a molecular weight of 347.18 g/mol. Its IUPAC name is 2-[(5,6-dichloro-3-pyridinyl)sulfonylamino]benzoic acid.
| Compound Name | 2-[(5,6-dichloro-3-pyridinyl)sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 64607834 |
| Molecular Formula | C12H8Cl2N2O4S |
| Molecular Weight | 347.18 g/mol |
| Exact Mass | 345.96 |
| IUPAC Name | 2-[(5,6-dichloro-3-pyridinyl)sulfonylamino]benzoic acid |
| SMILES | O=C(O)c1ccccc1NS(=O)(=O)c1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H8Cl2N2O4S/c13-9-5-7(6-15-11(9)14)21(19,20)16-10-4-2-1-3-8(10)12(17)18/h1-6,16H,(H,17,18) |
| InChIKey | SBEBNGIBGMFDPC-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.18 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|