C11H5Cl5N2O2S — CID 4731003
5,6-dichloro-N-(2,4,5-trichlorophenyl)pyridine-3-sulfonamide (PubChem CID 4731003) has the molecular formula C11H5Cl5N2O2S and a molecular weight of 406.51 g/mol. Its IUPAC name is 5,6-dichloro-N-(2,4,5-trichlorophenyl)pyridine-3-sulfonamide.
| Compound Name | 5,6-dichloro-N-(2,4,5-trichlorophenyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 4731003 |
| Molecular Formula | C11H5Cl5N2O2S |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 403.85 |
| IUPAC Name | 5,6-dichloro-N-(2,4,5-trichlorophenyl)pyridine-3-sulfonamide |
| SMILES | O=S(=O)(Nc1cc(Cl)c(Cl)cc1Cl)c1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H5Cl5N2O2S/c12-6-2-8(14)10(3-7(6)13)18-21(19,20)5-1-9(15)11(16)17-4-5/h1-4,18H |
| InChIKey | SHMVGKKGWKUXRN-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|