C10H10Cl2N4O2S — CID 64625172
5,6-dichloro-N-(2,5-dimethylpyrazol-3-yl)pyridine-3-sulfonamide (PubChem CID 64625172) has the molecular formula C10H10Cl2N4O2S and a molecular weight of 321.19 g/mol. Its IUPAC name is 5,6-dichloro-N-(2,5-dimethylpyrazol-3-yl)pyridine-3-sulfonamide.
| Compound Name | 5,6-dichloro-N-(2,5-dimethylpyrazol-3-yl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 64625172 |
| Molecular Formula | C10H10Cl2N4O2S |
| Molecular Weight | 321.19 g/mol |
| Exact Mass | 319.99 |
| IUPAC Name | 5,6-dichloro-N-(2,5-dimethylpyrazol-3-yl)pyridine-3-sulfonamide |
| SMILES | Cc1cc(NS(=O)(=O)c2cnc(Cl)c(Cl)c2)n(C)n1 |
| InChI | InChI=1S/C10H10Cl2N4O2S/c1-6-3-9(16(2)14-6)15-19(17,18)7-4-8(11)10(12)13-5-7/h3-5,15H,1-2H3 |
| InChIKey | VNSDKSZAQMSWSX-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.19 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|