C11H13ClN4O2S — CID 54888795
2-amino-5-chloro-N-(2,5-dimethylpyrazol-3-yl)benzenesulfonamide (PubChem CID 54888795) has the molecular formula C11H13ClN4O2S and a molecular weight of 300.77 g/mol. Its IUPAC name is 2-amino-5-chloro-N-(2,5-dimethylpyrazol-3-yl)benzenesulfonamide.
| Compound Name | 2-amino-5-chloro-N-(2,5-dimethylpyrazol-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 54888795 |
| Molecular Formula | C11H13ClN4O2S |
| Molecular Weight | 300.77 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | 2-amino-5-chloro-N-(2,5-dimethylpyrazol-3-yl)benzenesulfonamide |
| SMILES | Cc1cc(NS(=O)(=O)c2cc(Cl)ccc2N)n(C)n1 |
| InChI | InChI=1S/C11H13ClN4O2S/c1-7-5-11(16(2)14-7)15-19(17,18)10-6-8(12)3-4-9(10)13/h3-6,15H,13H2,1-2H3 |
| InChIKey | RNDKLMSKBXOQMV-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.77 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|