C11H12F2N4O2S — CID 107343064
3-amino-N-(2,5-dimethylpyrazol-3-yl)-2,4-difluorobenzenesulfonamide (PubChem CID 107343064) has the molecular formula C11H12F2N4O2S and a molecular weight of 302.31 g/mol. Its IUPAC name is 3-amino-N-(2,5-dimethylpyrazol-3-yl)-2,4-difluorobenzenesulfonamide.
| Compound Name | 3-amino-N-(2,5-dimethylpyrazol-3-yl)-2,4-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 107343064 |
| Molecular Formula | C11H12F2N4O2S |
| Molecular Weight | 302.31 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | 3-amino-N-(2,5-dimethylpyrazol-3-yl)-2,4-difluorobenzenesulfonamide |
| SMILES | Cc1cc(NS(=O)(=O)c2ccc(F)c(N)c2F)n(C)n1 |
| InChI | InChI=1S/C11H12F2N4O2S/c1-6-5-9(17(2)15-6)16-20(18,19)8-4-3-7(12)11(14)10(8)13/h3-5,16H,14H2,1-2H3 |
| InChIKey | BWXIXZDWUUPOQD-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.31 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|