C9H8F2N4O2S2 — CID 107343891
3-amino-2,4-difluoro-N-(3-methyl-1,2,4-thiadiazol-5-yl)benzenesulfonamide (PubChem CID 107343891) has the molecular formula C9H8F2N4O2S2 and a molecular weight of 306.32 g/mol. Its IUPAC name is 3-amino-2,4-difluoro-N-(3-methyl-1,2,4-thiadiazol-5-yl)benzenesulfonamide.
| Compound Name | 3-amino-2,4-difluoro-N-(3-methyl-1,2,4-thiadiazol-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 107343891 |
| Molecular Formula | C9H8F2N4O2S2 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.01 |
| IUPAC Name | 3-amino-2,4-difluoro-N-(3-methyl-1,2,4-thiadiazol-5-yl)benzenesulfonamide |
| SMILES | Cc1nsc(NS(=O)(=O)c2ccc(F)c(N)c2F)n1 |
| InChI | InChI=1S/C9H8F2N4O2S2/c1-4-13-9(18-14-4)15-19(16,17)6-3-2-5(10)8(12)7(6)11/h2-3H,12H2,1H3,(H,13,14,15) |
| InChIKey | WELGUHCWYDNNLO-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|