C9H7BrClFN4O2S2 — CID 103077729
3-amino-4-bromo-5-chloro-2-fluoro-N-(3-methyl-1,2,4-thiadiazol-5-yl)benzenesulfonamide (PubChem CID 103077729) has the molecular formula C9H7BrClFN4O2S2 and a molecular weight of 401.67 g/mol. Its IUPAC name is 3-amino-4-bromo-5-chloro-2-fluoro-N-(3-methyl-1,2,4-thiadiazol-5-yl)benzenesulfonamide.
| Compound Name | 3-amino-4-bromo-5-chloro-2-fluoro-N-(3-methyl-1,2,4-thiadiazol-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 103077729 |
| Molecular Formula | C9H7BrClFN4O2S2 |
| Molecular Weight | 401.67 g/mol |
| Exact Mass | 399.89 |
| IUPAC Name | 3-amino-4-bromo-5-chloro-2-fluoro-N-(3-methyl-1,2,4-thiadiazol-5-yl)benzenesulfonamide |
| SMILES | Cc1nsc(NS(=O)(=O)c2cc(Cl)c(Br)c(N)c2F)n1 |
| InChI | InChI=1S/C9H7BrClFN4O2S2/c1-3-14-9(19-15-3)16-20(17,18)5-2-4(11)6(10)8(13)7(5)12/h2H,13H2,1H3,(H,14,15,16) |
| InChIKey | HUOZUYZLFNIUOJ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.67 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|