C10H7BrClFN4O2S — CID 103077216
3-amino-4-bromo-5-chloro-2-fluoro-N-pyrimidin-2-ylbenzenesulfonamide (PubChem CID 103077216) has the molecular formula C10H7BrClFN4O2S and a molecular weight of 381.61 g/mol. Its IUPAC name is 3-amino-4-bromo-5-chloro-2-fluoro-N-pyrimidin-2-ylbenzenesulfonamide.
| Compound Name | 3-amino-4-bromo-5-chloro-2-fluoro-N-pyrimidin-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 103077216 |
| Molecular Formula | C10H7BrClFN4O2S |
| Molecular Weight | 381.61 g/mol |
| Exact Mass | 379.91 |
| IUPAC Name | 3-amino-4-bromo-5-chloro-2-fluoro-N-pyrimidin-2-ylbenzenesulfonamide |
| SMILES | Nc1c(F)c(S(=O)(=O)Nc2ncccn2)cc(Cl)c1Br |
| InChI | InChI=1S/C10H7BrClFN4O2S/c11-7-5(12)4-6(8(13)9(7)14)20(18,19)17-10-15-2-1-3-16-10/h1-4H,14H2,(H,15,16,17) |
| InChIKey | OAYBFKPPSIBFJP-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.61 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|