C11H15BrClFN2O2S — CID 103077381
3-amino-4-bromo-5-chloro-N-(2,2-dimethylpropyl)-2-fluorobenzenesulfonamide (PubChem CID 103077381) has the molecular formula C11H15BrClFN2O2S and a molecular weight of 373.68 g/mol. Its IUPAC name is 3-amino-4-bromo-5-chloro-N-(2,2-dimethylpropyl)-2-fluorobenzenesulfonamide.
| Compound Name | 3-amino-4-bromo-5-chloro-N-(2,2-dimethylpropyl)-2-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 103077381 |
| Molecular Formula | C11H15BrClFN2O2S |
| Molecular Weight | 373.68 g/mol |
| Exact Mass | 371.97 |
| IUPAC Name | 3-amino-4-bromo-5-chloro-N-(2,2-dimethylpropyl)-2-fluorobenzenesulfonamide |
| SMILES | CC(C)(C)CNS(=O)(=O)c1cc(Cl)c(Br)c(N)c1F |
| InChI | InChI=1S/C11H15BrClFN2O2S/c1-11(2,3)5-16-19(17,18)7-4-6(13)8(12)10(15)9(7)14/h4,16H,5,15H2,1-3H3 |
| InChIKey | QHPAKFNRUGJFQY-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.68 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|