C10H13BrClFN2O3S2 — CID 103077682
3-amino-4-bromo-5-chloro-2-fluoro-N-(2-methylsulfinylpropyl)benzenesulfonamide (PubChem CID 103077682) has the molecular formula C10H13BrClFN2O3S2 and a molecular weight of 407.71 g/mol. Its IUPAC name is 3-amino-4-bromo-5-chloro-2-fluoro-N-(2-methylsulfinylpropyl)benzenesulfonamide.
| Compound Name | 3-amino-4-bromo-5-chloro-2-fluoro-N-(2-methylsulfinylpropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 103077682 |
| Molecular Formula | C10H13BrClFN2O3S2 |
| Molecular Weight | 407.71 g/mol |
| Exact Mass | 405.92 |
| IUPAC Name | 3-amino-4-bromo-5-chloro-2-fluoro-N-(2-methylsulfinylpropyl)benzenesulfonamide |
| SMILES | CC(CNS(=O)(=O)c1cc(Cl)c(Br)c(N)c1F)S(C)=O |
| InChI | InChI=1S/C10H13BrClFN2O3S2/c1-5(19(2)16)4-15-20(17,18)7-3-6(12)8(11)10(14)9(7)13/h3,5,15H,4,14H2,1-2H3 |
| InChIKey | MGJUCTIIQXJUGC-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.71 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|