C10H11BrClFN2O4S — CID 103077410
methyl 2-[(3-amino-4-bromo-5-chloro-2-fluorophenyl)sulfonylamino]propanoate (PubChem CID 103077410) has the molecular formula C10H11BrClFN2O4S and a molecular weight of 389.63 g/mol. Its IUPAC name is methyl 2-[(3-amino-4-bromo-5-chloro-2-fluorophenyl)sulfonylamino]propanoate.
| Compound Name | methyl 2-[(3-amino-4-bromo-5-chloro-2-fluorophenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 103077410 |
| Molecular Formula | C10H11BrClFN2O4S |
| Molecular Weight | 389.63 g/mol |
| Exact Mass | 387.93 |
| IUPAC Name | methyl 2-[(3-amino-4-bromo-5-chloro-2-fluorophenyl)sulfonylamino]propanoate |
| SMILES | COC(=O)C(C)NS(=O)(=O)c1cc(Cl)c(Br)c(N)c1F |
| InChI | InChI=1S/C10H11BrClFN2O4S/c1-4(10(16)19-2)15-20(17,18)6-3-5(12)7(11)9(14)8(6)13/h3-4,15H,14H2,1-2H3 |
| InChIKey | FHJIWARKIZSXOK-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.63 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|