C9H10BrClFN3O3S — CID 103077289
2-[(3-amino-4-bromo-5-chloro-2-fluorophenyl)sulfonylamino]propanamide (PubChem CID 103077289) has the molecular formula C9H10BrClFN3O3S and a molecular weight of 374.62 g/mol. Its IUPAC name is 2-[(3-amino-4-bromo-5-chloro-2-fluorophenyl)sulfonylamino]propanamide.
| Compound Name | 2-[(3-amino-4-bromo-5-chloro-2-fluorophenyl)sulfonylamino]propanamide |
|---|---|
| PubChem CID | 103077289 |
| Molecular Formula | C9H10BrClFN3O3S |
| Molecular Weight | 374.62 g/mol |
| Exact Mass | 372.93 |
| IUPAC Name | 2-[(3-amino-4-bromo-5-chloro-2-fluorophenyl)sulfonylamino]propanamide |
| SMILES | CC(NS(=O)(=O)c1cc(Cl)c(Br)c(N)c1F)C(N)=O |
| InChI | InChI=1S/C9H10BrClFN3O3S/c1-3(9(14)16)15-19(17,18)5-2-4(11)6(10)8(13)7(5)12/h2-3,15H,13H2,1H3,(H2,14,16) |
| InChIKey | HUAYMIKPEQOLMR-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.62 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|