C10H13BrClFN2O2S — CID 103077166
3-amino-4-bromo-5-chloro-2-fluoro-N-methyl-N-propan-2-ylbenzenesulfonamide (PubChem CID 103077166) has the molecular formula C10H13BrClFN2O2S and a molecular weight of 359.65 g/mol. Its IUPAC name is 3-amino-4-bromo-5-chloro-2-fluoro-N-methyl-N-propan-2-ylbenzenesulfonamide.
| Compound Name | 3-amino-4-bromo-5-chloro-2-fluoro-N-methyl-N-propan-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 103077166 |
| Molecular Formula | C10H13BrClFN2O2S |
| Molecular Weight | 359.65 g/mol |
| Exact Mass | 357.96 |
| IUPAC Name | 3-amino-4-bromo-5-chloro-2-fluoro-N-methyl-N-propan-2-ylbenzenesulfonamide |
| SMILES | CC(C)N(C)S(=O)(=O)c1cc(Cl)c(Br)c(N)c1F |
| InChI | InChI=1S/C10H13BrClFN2O2S/c1-5(2)15(3)18(16,17)7-4-6(12)8(11)10(14)9(7)13/h4-5H,14H2,1-3H3 |
| InChIKey | DFXJACCRGLVRKA-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.65 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|