C11H15BrClFN2O2S — CID 103077254
3-amino-4-bromo-N-butan-2-yl-5-chloro-2-fluoro-N-methylbenzenesulfonamide (PubChem CID 103077254) has the molecular formula C11H15BrClFN2O2S and a molecular weight of 373.68 g/mol. Its IUPAC name is 3-amino-4-bromo-N-butan-2-yl-5-chloro-2-fluoro-N-methylbenzenesulfonamide.
| Compound Name | 3-amino-4-bromo-N-butan-2-yl-5-chloro-2-fluoro-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 103077254 |
| Molecular Formula | C11H15BrClFN2O2S |
| Molecular Weight | 373.68 g/mol |
| Exact Mass | 371.97 |
| IUPAC Name | 3-amino-4-bromo-N-butan-2-yl-5-chloro-2-fluoro-N-methylbenzenesulfonamide |
| SMILES | CCC(C)N(C)S(=O)(=O)c1cc(Cl)c(Br)c(N)c1F |
| InChI | InChI=1S/C11H15BrClFN2O2S/c1-4-6(2)16(3)19(17,18)8-5-7(13)9(12)11(15)10(8)14/h5-6H,4,15H2,1-3H3 |
| InChIKey | OTRRZGTVQPMXIZ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.68 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|