C12H17BrClFN2O3S — CID 103077625
3-amino-4-bromo-5-chloro-2-fluoro-N-(2-methoxyethyl)-N-propan-2-ylbenzenesulfonamide (PubChem CID 103077625) has the molecular formula C12H17BrClFN2O3S and a molecular weight of 403.70 g/mol. Its IUPAC name is 3-amino-4-bromo-5-chloro-2-fluoro-N-(2-methoxyethyl)-N-propan-2-ylbenzenesulfonamide.
| Compound Name | 3-amino-4-bromo-5-chloro-2-fluoro-N-(2-methoxyethyl)-N-propan-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 103077625 |
| Molecular Formula | C12H17BrClFN2O3S |
| Molecular Weight | 403.70 g/mol |
| Exact Mass | 401.98 |
| IUPAC Name | 3-amino-4-bromo-5-chloro-2-fluoro-N-(2-methoxyethyl)-N-propan-2-ylbenzenesulfonamide |
| SMILES | COCCN(C(C)C)S(=O)(=O)c1cc(Cl)c(Br)c(N)c1F |
| InChI | InChI=1S/C12H17BrClFN2O3S/c1-7(2)17(4-5-20-3)21(18,19)9-6-8(14)10(13)12(16)11(9)15/h6-7H,4-5,16H2,1-3H3 |
| InChIKey | QZPWZXYPOLACLY-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.70 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|