C13H20ClFN2O2S — CID 61112943
5-amino-3-chloro-2-fluoro-N-methyl-N-(4-methylpentan-2-yl)benzenesulfonamide (PubChem CID 61112943) has the molecular formula C13H20ClFN2O2S and a molecular weight of 322.83 g/mol. Its IUPAC name is 5-amino-3-chloro-2-fluoro-N-methyl-N-(4-methylpentan-2-yl)benzenesulfonamide.
| Compound Name | 5-amino-3-chloro-2-fluoro-N-methyl-N-(4-methylpentan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 61112943 |
| Molecular Formula | C13H20ClFN2O2S |
| Molecular Weight | 322.83 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | 5-amino-3-chloro-2-fluoro-N-methyl-N-(4-methylpentan-2-yl)benzenesulfonamide |
| SMILES | CC(C)CC(C)N(C)S(=O)(=O)c1cc(N)cc(Cl)c1F |
| InChI | InChI=1S/C13H20ClFN2O2S/c1-8(2)5-9(3)17(4)20(18,19)12-7-10(16)6-11(14)13(12)15/h6-9H,5,16H2,1-4H3 |
| InChIKey | FNFACDXCGHKJJE-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.83 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|