C11H16F2N2O2S2 — CID 112656684
5-amino-2,3-difluoro-N-methyl-N-(1-methylsulfanylpropan-2-yl)benzenesulfonamide (PubChem CID 112656684) has the molecular formula C11H16F2N2O2S2 and a molecular weight of 310.39 g/mol. Its IUPAC name is 5-amino-2,3-difluoro-N-methyl-N-(1-methylsulfanylpropan-2-yl)benzenesulfonamide.
| Compound Name | 5-amino-2,3-difluoro-N-methyl-N-(1-methylsulfanylpropan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 112656684 |
| Molecular Formula | C11H16F2N2O2S2 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | 5-amino-2,3-difluoro-N-methyl-N-(1-methylsulfanylpropan-2-yl)benzenesulfonamide |
| SMILES | CSCC(C)N(C)S(=O)(=O)c1cc(N)cc(F)c1F |
| InChI | InChI=1S/C11H16F2N2O2S2/c1-7(6-18-3)15(2)19(16,17)10-5-8(14)4-9(12)11(10)13/h4-5,7H,6,14H2,1-3H3 |
| InChIKey | LICJUXLZEWKBSM-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|