C12H19FN2O2S2 — CID 112667435
5-(aminomethyl)-2-fluoro-N-methyl-N-(1-methylsulfanylpropan-2-yl)benzenesulfonamide (PubChem CID 112667435) has the molecular formula C12H19FN2O2S2 and a molecular weight of 306.43 g/mol. Its IUPAC name is 5-(aminomethyl)-2-fluoro-N-methyl-N-(1-methylsulfanylpropan-2-yl)benzenesulfonamide.
| Compound Name | 5-(aminomethyl)-2-fluoro-N-methyl-N-(1-methylsulfanylpropan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 112667435 |
| Molecular Formula | C12H19FN2O2S2 |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | 5-(aminomethyl)-2-fluoro-N-methyl-N-(1-methylsulfanylpropan-2-yl)benzenesulfonamide |
| SMILES | CSCC(C)N(C)S(=O)(=O)c1cc(CN)ccc1F |
| InChI | InChI=1S/C12H19FN2O2S2/c1-9(8-18-3)15(2)19(16,17)12-6-10(7-14)4-5-11(12)13/h4-6,9H,7-8,14H2,1-3H3 |
| InChIKey | NGFPSMVZWHIPET-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |