C9H16N2O2S3 — CID 112656690
4-amino-N-methyl-N-(1-methylsulfanylpropan-2-yl)thiophene-2-sulfonamide (PubChem CID 112656690) has the molecular formula C9H16N2O2S3 and a molecular weight of 280.44 g/mol. Its IUPAC name is 4-amino-N-methyl-N-(1-methylsulfanylpropan-2-yl)thiophene-2-sulfonamide.
| Compound Name | 4-amino-N-methyl-N-(1-methylsulfanylpropan-2-yl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 112656690 |
| Molecular Formula | C9H16N2O2S3 |
| Molecular Weight | 280.44 g/mol |
| Exact Mass | 280.04 |
| IUPAC Name | 4-amino-N-methyl-N-(1-methylsulfanylpropan-2-yl)thiophene-2-sulfonamide |
| SMILES | CSCC(C)N(C)S(=O)(=O)c1cc(N)cs1 |
| InChI | InChI=1S/C9H16N2O2S3/c1-7(5-14-3)11(2)16(12,13)9-4-8(10)6-15-9/h4,6-7H,5,10H2,1-3H3 |
| InChIKey | PKEXUQQBXYPDPH-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.44 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |