C8H14N2O4S3 — CID 79850156
4-amino-N-methyl-N-(2-methylsulfonylethyl)thiophene-2-sulfonamide (PubChem CID 79850156) has the molecular formula C8H14N2O4S3 and a molecular weight of 298.41 g/mol. Its IUPAC name is 4-amino-N-methyl-N-(2-methylsulfonylethyl)thiophene-2-sulfonamide.
| Compound Name | 4-amino-N-methyl-N-(2-methylsulfonylethyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 79850156 |
| Molecular Formula | C8H14N2O4S3 |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.01 |
| IUPAC Name | 4-amino-N-methyl-N-(2-methylsulfonylethyl)thiophene-2-sulfonamide |
| SMILES | CN(CCS(C)(=O)=O)S(=O)(=O)c1cc(N)cs1 |
| InChI | InChI=1S/C8H14N2O4S3/c1-10(3-4-16(2,11)12)17(13,14)8-5-7(9)6-15-8/h5-6H,3-4,9H2,1-2H3 |
| InChIKey | YBSRBWDPOOXVBP-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |