C10H18N2O4S2 — CID 61300165
4-amino-N,N-bis(2-methoxyethyl)thiophene-2-sulfonamide (PubChem CID 61300165) has the molecular formula C10H18N2O4S2 and a molecular weight of 294.40 g/mol. Its IUPAC name is 4-amino-N,N-bis(2-methoxyethyl)thiophene-2-sulfonamide.
| Compound Name | 4-amino-N,N-bis(2-methoxyethyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 61300165 |
| Molecular Formula | C10H18N2O4S2 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | 4-amino-N,N-bis(2-methoxyethyl)thiophene-2-sulfonamide |
| SMILES | COCCN(CCOC)S(=O)(=O)c1cc(N)cs1 |
| InChI | InChI=1S/C10H18N2O4S2/c1-15-5-3-12(4-6-16-2)18(13,14)10-7-9(11)8-17-10/h7-8H,3-6,11H2,1-2H3 |
| InChIKey | FDXBXMZIAHYAFK-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |