C11H18N2O3S3 — CID 61301523
4-amino-N-(2-methoxyethyl)-N-(thiolan-3-yl)thiophene-2-sulfonamide (PubChem CID 61301523) has the molecular formula C11H18N2O3S3 and a molecular weight of 322.48 g/mol. Its IUPAC name is 4-amino-N-(2-methoxyethyl)-N-(thiolan-3-yl)thiophene-2-sulfonamide.
| Compound Name | 4-amino-N-(2-methoxyethyl)-N-(thiolan-3-yl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 61301523 |
| Molecular Formula | C11H18N2O3S3 |
| Molecular Weight | 322.48 g/mol |
| Exact Mass | 322.05 |
| IUPAC Name | 4-amino-N-(2-methoxyethyl)-N-(thiolan-3-yl)thiophene-2-sulfonamide |
| SMILES | COCCN(C1CCSC1)S(=O)(=O)c1cc(N)cs1 |
| InChI | InChI=1S/C11H18N2O3S3/c1-16-4-3-13(10-2-5-17-8-10)19(14,15)11-6-9(12)7-18-11/h6-7,10H,2-5,8,12H2,1H3 |
| InChIKey | BMILJFSSMGHENH-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.48 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |