C13H17FN2O5S2 — CID 47062215
2-fluoro-N-(2-methoxyethyl)-4-nitro-N-(thiolan-3-yl)benzenesulfonamide (PubChem CID 47062215) has the molecular formula C13H17FN2O5S2 and a molecular weight of 364.42 g/mol. Its IUPAC name is 2-fluoro-N-(2-methoxyethyl)-4-nitro-N-(thiolan-3-yl)benzenesulfonamide.
| Compound Name | 2-fluoro-N-(2-methoxyethyl)-4-nitro-N-(thiolan-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 47062215 |
| Molecular Formula | C13H17FN2O5S2 |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.06 |
| IUPAC Name | 2-fluoro-N-(2-methoxyethyl)-4-nitro-N-(thiolan-3-yl)benzenesulfonamide |
| SMILES | COCCN(C1CCSC1)S(=O)(=O)c1ccc([N+](=O)[O-])cc1F |
| InChI | InChI=1S/C13H17FN2O5S2/c1-21-6-5-15(11-4-7-22-9-11)23(19,20)13-3-2-10(16(17)18)8-12(13)14/h2-3,8,11H,4-7,9H2,1H3 |
| InChIKey | ICQJBFRYCJHFTP-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|