C12H18BrNO3S3 — CID 79924452
5-bromo-N-(2-methoxyethyl)-4-methyl-N-(thiolan-3-yl)thiophene-2-sulfonamide (PubChem CID 79924452) has the molecular formula C12H18BrNO3S3 and a molecular weight of 400.39 g/mol. Its IUPAC name is 5-bromo-N-(2-methoxyethyl)-4-methyl-N-(thiolan-3-yl)thiophene-2-sulfonamide.
| Compound Name | 5-bromo-N-(2-methoxyethyl)-4-methyl-N-(thiolan-3-yl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 79924452 |
| Molecular Formula | C12H18BrNO3S3 |
| Molecular Weight | 400.39 g/mol |
| Exact Mass | 398.96 |
| IUPAC Name | 5-bromo-N-(2-methoxyethyl)-4-methyl-N-(thiolan-3-yl)thiophene-2-sulfonamide |
| SMILES | COCCN(C1CCSC1)S(=O)(=O)c1cc(C)c(Br)s1 |
| InChI | InChI=1S/C12H18BrNO3S3/c1-9-7-11(19-12(9)13)20(15,16)14(4-5-17-2)10-3-6-18-8-10/h7,10H,3-6,8H2,1-2H3 |
| InChIKey | CVMBNKVEDDJDLO-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.39 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |