C15H22N2O2S — CID 60945101
4-amino-N-(2-methoxyethyl)-3-methyl-N-(thiolan-3-yl)benzamide (PubChem CID 60945101) has the molecular formula C15H22N2O2S and a molecular weight of 294.42 g/mol. Its IUPAC name is 4-amino-N-(2-methoxyethyl)-3-methyl-N-(thiolan-3-yl)benzamide.
| Compound Name | 4-amino-N-(2-methoxyethyl)-3-methyl-N-(thiolan-3-yl)benzamide |
|---|---|
| PubChem CID | 60945101 |
| Molecular Formula | C15H22N2O2S |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | 4-amino-N-(2-methoxyethyl)-3-methyl-N-(thiolan-3-yl)benzamide |
| SMILES | COCCN(C(=O)c1ccc(N)c(C)c1)C1CCSC1 |
| InChI | InChI=1S/C15H22N2O2S/c1-11-9-12(3-4-14(11)16)15(18)17(6-7-19-2)13-5-8-20-10-13/h3-4,9,13H,5-8,10,16H2,1-2H3 |
| InChIKey | PRXZLYMXOCGMKS-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|