C14H17Br2NO2S — CID 103883157
2,4-dibromo-N-(2-methoxyethyl)-N-(thiolan-3-yl)benzamide (PubChem CID 103883157) has the molecular formula C14H17Br2NO2S and a molecular weight of 423.17 g/mol. Its IUPAC name is 2,4-dibromo-N-(2-methoxyethyl)-N-(thiolan-3-yl)benzamide.
| Compound Name | 2,4-dibromo-N-(2-methoxyethyl)-N-(thiolan-3-yl)benzamide |
|---|---|
| PubChem CID | 103883157 |
| Molecular Formula | C14H17Br2NO2S |
| Molecular Weight | 423.17 g/mol |
| Exact Mass | 420.93 |
| IUPAC Name | 2,4-dibromo-N-(2-methoxyethyl)-N-(thiolan-3-yl)benzamide |
| SMILES | COCCN(C(=O)c1ccc(Br)cc1Br)C1CCSC1 |
| InChI | InChI=1S/C14H17Br2NO2S/c1-19-6-5-17(11-4-7-20-9-11)14(18)12-3-2-10(15)8-13(12)16/h2-3,8,11H,4-7,9H2,1H3 |
| InChIKey | BHCJKUQWRFPRMQ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.17 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |