C14H18F2N2O2S — CID 79759087
3-amino-2,6-difluoro-N-(2-methoxyethyl)-N-(thiolan-3-yl)benzamide (PubChem CID 79759087) has the molecular formula C14H18F2N2O2S and a molecular weight of 316.37 g/mol. Its IUPAC name is 3-amino-2,6-difluoro-N-(2-methoxyethyl)-N-(thiolan-3-yl)benzamide.
| Compound Name | 3-amino-2,6-difluoro-N-(2-methoxyethyl)-N-(thiolan-3-yl)benzamide |
|---|---|
| PubChem CID | 79759087 |
| Molecular Formula | C14H18F2N2O2S |
| Molecular Weight | 316.37 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | 3-amino-2,6-difluoro-N-(2-methoxyethyl)-N-(thiolan-3-yl)benzamide |
| SMILES | COCCN(C(=O)c1c(F)ccc(N)c1F)C1CCSC1 |
| InChI | InChI=1S/C14H18F2N2O2S/c1-20-6-5-18(9-4-7-21-8-9)14(19)12-10(15)2-3-11(17)13(12)16/h2-3,9H,4-8,17H2,1H3 |
| InChIKey | PXMYPAIDWVDIOF-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.37 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|