C14H20F2N2O2 — CID 79773295
3-amino-2,6-difluoro-N-(2-methoxyethyl)-N-(2-methylpropyl)benzamide (PubChem CID 79773295) has the molecular formula C14H20F2N2O2 and a molecular weight of 286.32 g/mol. Its IUPAC name is 3-amino-2,6-difluoro-N-(2-methoxyethyl)-N-(2-methylpropyl)benzamide.
| Compound Name | 3-amino-2,6-difluoro-N-(2-methoxyethyl)-N-(2-methylpropyl)benzamide |
|---|---|
| PubChem CID | 79773295 |
| Molecular Formula | C14H20F2N2O2 |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | 3-amino-2,6-difluoro-N-(2-methoxyethyl)-N-(2-methylpropyl)benzamide |
| SMILES | COCCN(CC(C)C)C(=O)c1c(F)ccc(N)c1F |
| InChI | InChI=1S/C14H20F2N2O2/c1-9(2)8-18(6-7-20-3)14(19)12-10(15)4-5-11(17)13(12)16/h4-5,9H,6-8,17H2,1-3H3 |
| InChIKey | ZVYTYYCZYGCECF-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|