C13H17F2N3O2 — CID 79773800
3-amino-N-(2-amino-2-oxoethyl)-2,6-difluoro-N-(2-methylpropyl)benzamide (PubChem CID 79773800) has the molecular formula C13H17F2N3O2 and a molecular weight of 285.29 g/mol. Its IUPAC name is 3-amino-N-(2-amino-2-oxoethyl)-2,6-difluoro-N-(2-methylpropyl)benzamide.
| Compound Name | 3-amino-N-(2-amino-2-oxoethyl)-2,6-difluoro-N-(2-methylpropyl)benzamide |
|---|---|
| PubChem CID | 79773800 |
| Molecular Formula | C13H17F2N3O2 |
| Molecular Weight | 285.29 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | 3-amino-N-(2-amino-2-oxoethyl)-2,6-difluoro-N-(2-methylpropyl)benzamide |
| SMILES | CC(C)CN(CC(N)=O)C(=O)c1c(F)ccc(N)c1F |
| InChI | InChI=1S/C13H17F2N3O2/c1-7(2)5-18(6-10(17)19)13(20)11-8(14)3-4-9(16)12(11)15/h3-4,7H,5-6,16H2,1-2H3,(H2,17,19) |
| InChIKey | XIFTVZIQCAGPOM-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.29 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|