C15H21BrN2O2S — CID 60955201
4-bromo-1-cyclopropyl-N-(2-methoxyethyl)-N-(thiolan-3-yl)pyrrole-2-carboxamide (PubChem CID 60955201) has the molecular formula C15H21BrN2O2S and a molecular weight of 373.32 g/mol. Its IUPAC name is 4-bromo-1-cyclopropyl-N-(2-methoxyethyl)-N-(thiolan-3-yl)pyrrole-2-carboxamide.
| Compound Name | 4-bromo-1-cyclopropyl-N-(2-methoxyethyl)-N-(thiolan-3-yl)pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 60955201 |
| Molecular Formula | C15H21BrN2O2S |
| Molecular Weight | 373.32 g/mol |
| Exact Mass | 372.05 |
| IUPAC Name | 4-bromo-1-cyclopropyl-N-(2-methoxyethyl)-N-(thiolan-3-yl)pyrrole-2-carboxamide |
| SMILES | COCCN(C(=O)c1cc(Br)cn1C1CC1)C1CCSC1 |
| InChI | InChI=1S/C15H21BrN2O2S/c1-20-6-5-17(13-4-7-21-10-13)15(19)14-8-11(16)9-18(14)12-2-3-12/h8-9,12-13H,2-7,10H2,1H3 |
| InChIKey | FWEKVLNVGCWMGQ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.32 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |