C14H21BrN2O2 — CID 82950994
4-bromo-1-cyclopropyl-N-(2-methoxyethyl)-N-propan-2-ylpyrrole-2-carboxamide (PubChem CID 82950994) has the molecular formula C14H21BrN2O2 and a molecular weight of 329.24 g/mol. Its IUPAC name is 4-bromo-1-cyclopropyl-N-(2-methoxyethyl)-N-propan-2-ylpyrrole-2-carboxamide.
| Compound Name | 4-bromo-1-cyclopropyl-N-(2-methoxyethyl)-N-propan-2-ylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 82950994 |
| Molecular Formula | C14H21BrN2O2 |
| Molecular Weight | 329.24 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | 4-bromo-1-cyclopropyl-N-(2-methoxyethyl)-N-propan-2-ylpyrrole-2-carboxamide |
| SMILES | COCCN(C(=O)c1cc(Br)cn1C1CC1)C(C)C |
| InChI | InChI=1S/C14H21BrN2O2/c1-10(2)16(6-7-19-3)14(18)13-8-11(15)9-17(13)12-4-5-12/h8-10,12H,4-7H2,1-3H3 |
| InChIKey | AOQXXYHTFQJCAV-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.24 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |