C10H11BrN2O2S3 — CID 54982582
4-amino-N-[(5-bromothiophen-3-yl)methyl]-N-methylthiophene-2-sulfonamide (PubChem CID 54982582) has the molecular formula C10H11BrN2O2S3 and a molecular weight of 367.32 g/mol. Its IUPAC name is 4-amino-N-[(5-bromothiophen-3-yl)methyl]-N-methylthiophene-2-sulfonamide.
| Compound Name | 4-amino-N-[(5-bromothiophen-3-yl)methyl]-N-methylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 54982582 |
| Molecular Formula | C10H11BrN2O2S3 |
| Molecular Weight | 367.32 g/mol |
| Exact Mass | 365.92 |
| IUPAC Name | 4-amino-N-[(5-bromothiophen-3-yl)methyl]-N-methylthiophene-2-sulfonamide |
| SMILES | CN(Cc1csc(Br)c1)S(=O)(=O)c1cc(N)cs1 |
| InChI | InChI=1S/C10H11BrN2O2S3/c1-13(4-7-2-9(11)16-5-7)18(14,15)10-3-8(12)6-17-10/h2-3,5-6H,4,12H2,1H3 |
| InChIKey | NEFGCDPDEKBENV-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.32 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |