C9H14BrNO4S3 — CID 55174854
N-[(5-bromothiophen-3-yl)methyl]-N-methyl-2-methylsulfonylethanesulfonamide (PubChem CID 55174854) has the molecular formula C9H14BrNO4S3 and a molecular weight of 376.32 g/mol. Its IUPAC name is N-[(5-bromothiophen-3-yl)methyl]-N-methyl-2-methylsulfonylethanesulfonamide.
| Compound Name | N-[(5-bromothiophen-3-yl)methyl]-N-methyl-2-methylsulfonylethanesulfonamide |
|---|---|
| PubChem CID | 55174854 |
| Molecular Formula | C9H14BrNO4S3 |
| Molecular Weight | 376.32 g/mol |
| Exact Mass | 374.93 |
| IUPAC Name | N-[(5-bromothiophen-3-yl)methyl]-N-methyl-2-methylsulfonylethanesulfonamide |
| SMILES | CN(Cc1csc(Br)c1)S(=O)(=O)CCS(C)(=O)=O |
| InChI | InChI=1S/C9H14BrNO4S3/c1-11(6-8-5-9(10)16-7-8)18(14,15)4-3-17(2,12)13/h5,7H,3-4,6H2,1-2H3 |
| InChIKey | IOEWPUNGGZMVQA-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.32 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |